C22H24ClN3O2S — CID 87495629
N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1,4-benzodioxine-6-carbothioamide;hydrochloride (PubChem CID 87495629) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1,4-benzodioxine-6-carbothioamide;hydrochloride.
| Compound Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1,4-benzodioxine-6-carbothioamide;hydrochloride |
|---|---|
| PubChem CID | 87495629 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1,4-benzodioxine-6-carbothioamide;hydrochloride |
| SMILES | Cl.S=C(N[C@@H]1CCC[C@H](c2nc3ccccc3[nH]2)C1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H23N3O2S.ClH/c28-22(15-8-9-19-20(13-15)27-11-10-26-19)23-16-5-3-4-14(12-16)21-24-17-6-1-2-7-18(17)25-21;/h1-2,6-9,13-14,16H,3-5,10-12H2,(H,23,28)(H,24,25);1H/t14-,16+;/m0./s1 |
| InChIKey | TVMLHCUUTBGQIY-KUARMEPBSA-N |
| XLogP | 4.75 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|