C14H15BrClNO6 — CID 87496139
[(2R,3R,4R,5R)-2-bromooxy-1,5-dihydroxy-4-(1H-indol-2-yloxy)-6-oxohexan-3-yl] hypochlorite (PubChem CID 87496139) has the molecular formula C14H15BrClNO6 and a molecular weight of 408.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-bromooxy-1,5-dihydroxy-4-(1H-indol-2-yloxy)-6-oxohexan-3-yl] hypochlorite.
| Compound Name | [(2R,3R,4R,5R)-2-bromooxy-1,5-dihydroxy-4-(1H-indol-2-yloxy)-6-oxohexan-3-yl] hypochlorite |
|---|---|
| PubChem CID | 87496139 |
| Molecular Formula | C14H15BrClNO6 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | [(2R,3R,4R,5R)-2-bromooxy-1,5-dihydroxy-4-(1H-indol-2-yloxy)-6-oxohexan-3-yl] hypochlorite |
| SMILES | O=C[C@H](O)[C@@H](Oc1cc2ccccc2[nH]1)[C@@H](OCl)[C@@H](CO)OBr |
| InChI | InChI=1S/C14H15BrClNO6/c15-22-11(7-19)14(23-16)13(10(20)6-18)21-12-5-8-3-1-2-4-9(8)17-12/h1-6,10-11,13-14,17,19-20H,7H2/t10-,11+,13+,14-/m0/s1 |
| InChIKey | JYCSIBLDBKPUTL-UNJBNNCHSA-N |
| XLogP | 1.70 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|