About acetic acid;phosphonous acid
acetic acid;phosphonous acid (PubChem CID 87496831) has the molecular formula C2H7O4P
and a molecular weight of 126.05 g/mol. Its IUPAC name is acetic acid;phosphonous acid.
Molecular Properties
| Compound Name | acetic acid;phosphonous acid |
| PubChem CID | 87496831 |
| Molecular Formula | C2H7O4P |
| Molecular Weight | 126.05 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | acetic acid;phosphonous acid |
| SMILES | CC(=O)O.OPO |
| InChI | InChI=1S/C2H4O2.H3O2P/c1-2(3)4;1-3-2/h1H3,(H,3,4);1-3H |
| InChIKey | NEBWKCRSIUXSDI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.05 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;phosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;phosphonous acid?
The IUPAC name of acetic acid;phosphonous acid (CID 87496831) is acetic acid;phosphonous acid.
What is the SMILES notation for acetic acid;phosphonous acid?
The canonical SMILES for acetic acid;phosphonous acid is CC(=O)O.OPO.
What is the InChIKey of acetic acid;phosphonous acid?
The InChIKey is NEBWKCRSIUXSDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.H3O2P/c1-2(3)4;1-3-2/h1H3,(H,3,4);1-3H.
What are the key properties of acetic acid;phosphonous acid?
acetic acid;phosphonous acid has a molecular weight of 126.05 g/mol, XLogP of -0.43, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;phosphonous acid is sourced from PubChem (CID 87496831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).