C18H16Cl4N2O2 — CID 87499459
3-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride (PubChem CID 87499459) has the molecular formula C18H16Cl4N2O2 and a molecular weight of 434.15 g/mol. Its IUPAC name is 3-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride.
| Compound Name | 3-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 87499459 |
| Molecular Formula | C18H16Cl4N2O2 |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 3-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-4-(3,4-dichlorophenyl)pyrrolidine-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CC(CCOc2ccc(Cl)cn2)C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H16Cl4N2O2/c19-13-2-4-17(23-8-13)26-6-5-12-9-24(18(22)25)10-14(12)11-1-3-15(20)16(21)7-11/h1-4,7-8,12,14H,5-6,9-10H2 |
| InChIKey | IUWXIRQTWHCKMI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|