About sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane
sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane (PubChem CID 87500546) has the molecular formula C11H25N2NaO3
and a molecular weight of 256.32 g/mol. Its IUPAC name is sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane.
Molecular Properties
| Compound Name | sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane |
| PubChem CID | 87500546 |
| Molecular Formula | C11H25N2NaO3 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane |
| SMILES | NCC(N)(CCO)CC(=O)O.[CH2-]CCCC.[Na+] |
| InChI | InChI=1S/C6H14N2O3.C5H11.Na/c7-4-6(8,1-2-9)3-5(10)11;1-3-5-4-2;/h9H,1-4,7-8H2,(H,10,11);1,3-5H2,2H3;/q;-1;+1 |
| InChIKey | HGHWPRYSACINDH-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane?
The IUPAC name of sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane (CID 87500546) is sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane.
What is the SMILES notation for sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane?
The canonical SMILES for sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane is NCC(N)(CCO)CC(=O)O.[CH2-]CCCC.[Na+].
What is the InChIKey of sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane?
The InChIKey is HGHWPRYSACINDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3.C5H11.Na/c7-4-6(8,1-2-9)3-5(10)11;1-3-5-4-2;/h9H,1-4,7-8H2,(H,10,11);1,3-5H2,2H3;/q;-1;+1.
What are the key properties of sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane?
sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane has a molecular weight of 256.32 g/mol, XLogP of -2.49, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-amino-3-(aminomethyl)-5-hydroxypentanoic acid;pentane is sourced from PubChem (CID 87500546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).