C7H12ClNO6 — CID 141270736
3-amino-3-(carboxymethyl)pentanedioic acid;hydrochloride (PubChem CID 141270736) has the molecular formula C7H12ClNO6 and a molecular weight of 241.63 g/mol. Its IUPAC name is 3-amino-3-(carboxymethyl)pentanedioic acid;hydrochloride.
| Compound Name | 3-amino-3-(carboxymethyl)pentanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 141270736 |
| Molecular Formula | C7H12ClNO6 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 3-amino-3-(carboxymethyl)pentanedioic acid;hydrochloride |
| SMILES | Cl.NC(CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C7H11NO6.ClH/c8-7(1-4(9)10,2-5(11)12)3-6(13)14;/h1-3,8H2,(H,9,10)(H,11,12)(H,13,14);1H |
| InChIKey | FDKWKAIWFBRSEF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |