3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid

C11H18N2O8 — CID 11162546

IUPAC3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid
SMILESNC(CC(=O)O)(CC(=O)O)CC(N)(CC(=O)O)CC(=O)O
InChIInChI=1S/C11H18N2O8/c12-10(1-6(14)15,2-7(16)17)5-11(13,3-8(18)19)4-9(20)21/h1-5,12-13H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyLFOFHAVALVVXQC-UHFFFAOYSA-N
MW306.27 g/mol
LogP-1.33
Rot. Bonds10

About 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid

3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid (PubChem CID 11162546) has the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid.

Molecular Properties

Compound Name3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid
PubChem CID11162546
Molecular FormulaC11H18N2O8
Molecular Weight306.27 g/mol
Exact Mass306.11
IUPAC Name3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid
SMILESNC(CC(=O)O)(CC(=O)O)CC(N)(CC(=O)O)CC(=O)O
InChIInChI=1S/C11H18N2O8/c12-10(1-6(14)15,2-7(16)17)5-11(13,3-8(18)19)4-9(20)21/h1-5,12-13H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyLFOFHAVALVVXQC-UHFFFAOYSA-N
XLogP-1.33
TPSA201.24 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.27
LogP ≤ 5-1.33
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid?
The IUPAC name of 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid (CID 11162546) is 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid.
What is the SMILES notation for 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid?
The canonical SMILES for 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid is NC(CC(=O)O)(CC(=O)O)CC(N)(CC(=O)O)CC(=O)O.
What is the InChIKey of 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid?
The InChIKey is LFOFHAVALVVXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O8/c12-10(1-6(14)15,2-7(16)17)5-11(13,3-8(18)19)4-9(20)21/h1-5,12-13H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid?
3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid has a molecular weight of 306.27 g/mol, XLogP of -1.33, 10 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-3,5-bis(carboxymethyl)heptanedioic acid is sourced from PubChem (CID 11162546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).