C13H20N2O11 — CID 57266310
3,3-diamino-4,4,5-tris(carboxymethyl)-5-hydroxyheptanedioic acid (PubChem CID 57266310) has the molecular formula C13H20N2O11 and a molecular weight of 380.31 g/mol. Its IUPAC name is 3,3-diamino-4,4,5-tris(carboxymethyl)-5-hydroxyheptanedioic acid.
| Compound Name | 3,3-diamino-4,4,5-tris(carboxymethyl)-5-hydroxyheptanedioic acid |
|---|---|
| PubChem CID | 57266310 |
| Molecular Formula | C13H20N2O11 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3,3-diamino-4,4,5-tris(carboxymethyl)-5-hydroxyheptanedioic acid |
| SMILES | NC(N)(CC(=O)O)C(CC(=O)O)(CC(=O)O)C(O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H20N2O11/c14-13(15,5-10(24)25)11(1-6(16)17,2-7(18)19)12(26,3-8(20)21)4-9(22)23/h26H,1-5,14-15H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | OQCLLZBVCFJLMX-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 258.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|