2-amino-2-hydroxybutanedioic acid

C4H7NO5 — CID 10313218

IUPAC2-amino-2-hydroxybutanedioic acid
SMILESNC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C4H7NO5/c5-4(10,3(8)9)1-2(6)7/h10H,1,5H2,(H,6,7)(H,8,9)
InChIKeyDZYHJDLBFUOKBD-UHFFFAOYSA-N
MW149.10 g/mol
LogP-1.81
Rot. Bonds3

About 2-amino-2-hydroxybutanedioic acid

2-amino-2-hydroxybutanedioic acid (PubChem CID 10313218) has the molecular formula C4H7NO5 and a molecular weight of 149.10 g/mol. Its IUPAC name is 2-amino-2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2-amino-2-hydroxybutanedioic acid
PubChem CID10313218
Molecular FormulaC4H7NO5
Molecular Weight149.10 g/mol
Exact Mass149.03
IUPAC Name2-amino-2-hydroxybutanedioic acid
SMILESNC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C4H7NO5/c5-4(10,3(8)9)1-2(6)7/h10H,1,5H2,(H,6,7)(H,8,9)
InChIKeyDZYHJDLBFUOKBD-UHFFFAOYSA-N
XLogP-1.81
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.10
LogP ≤ 5-1.81
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-amino-2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-hydroxybutanedioic acid?
The IUPAC name of 2-amino-2-hydroxybutanedioic acid (CID 10313218) is 2-amino-2-hydroxybutanedioic acid.
What is the SMILES notation for 2-amino-2-hydroxybutanedioic acid?
The canonical SMILES for 2-amino-2-hydroxybutanedioic acid is NC(O)(CC(=O)O)C(=O)O.
What is the InChIKey of 2-amino-2-hydroxybutanedioic acid?
The InChIKey is DZYHJDLBFUOKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO5/c5-4(10,3(8)9)1-2(6)7/h10H,1,5H2,(H,6,7)(H,8,9).
What are the key properties of 2-amino-2-hydroxybutanedioic acid?
2-amino-2-hydroxybutanedioic acid has a molecular weight of 149.10 g/mol, XLogP of -1.81, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-hydroxybutanedioic acid is sourced from PubChem (CID 10313218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).