About 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid
3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid (PubChem CID 18954505) has the molecular formula C11H18N2O8
and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid.
Molecular Properties
| Compound Name | 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid |
| PubChem CID | 18954505 |
| Molecular Formula | C11H18N2O8 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid |
| SMILES | CNC(CC(=O)O)(CC(=O)O)C(N)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H18N2O8/c1-13-11(4-8(18)19,5-9(20)21)10(12,2-6(14)15)3-7(16)17/h13H,2-5,12H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | FZZBGDDZGGSOOJ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid?
The IUPAC name of 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid (CID 18954505) is 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid.
What is the SMILES notation for 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid?
The canonical SMILES for 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid is CNC(CC(=O)O)(CC(=O)O)C(N)(CC(=O)O)CC(=O)O.
What is the InChIKey of 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid?
The InChIKey is FZZBGDDZGGSOOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O8/c1-13-11(4-8(18)19,5-9(20)21)10(12,2-6(14)15)3-7(16)17/h13H,2-5,12H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid?
3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid has a molecular weight of 306.27 g/mol, XLogP of -1.46, 10 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,4-bis(carboxymethyl)-4-(methylamino)hexanedioic acid is sourced from PubChem (CID 18954505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).