C11H18N2O9 — CID 19019303
3,3-diamino-5,5-bis(carboxymethyl)-4-hydroxyheptanedioic acid (PubChem CID 19019303) has the molecular formula C11H18N2O9 and a molecular weight of 322.27 g/mol. Its IUPAC name is 3,3-diamino-5,5-bis(carboxymethyl)-4-hydroxyheptanedioic acid.
| Compound Name | 3,3-diamino-5,5-bis(carboxymethyl)-4-hydroxyheptanedioic acid |
|---|---|
| PubChem CID | 19019303 |
| Molecular Formula | C11H18N2O9 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3,3-diamino-5,5-bis(carboxymethyl)-4-hydroxyheptanedioic acid |
| SMILES | NC(N)(CC(=O)O)C(O)C(CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H18N2O9/c12-11(13,4-8(20)21)9(22)10(1-5(14)15,2-6(16)17)3-7(18)19/h9,22H,1-4,12-13H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | UNSSMUMQXQGLTA-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 221.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|