C10H16NNaO8 — CID 173286235
sodium;4-amino-3,3-bis(carboxymethyl)hexanedioic acid;hydride (PubChem CID 173286235) has the molecular formula C10H16NNaO8 and a molecular weight of 301.23 g/mol. Its IUPAC name is sodium;4-amino-3,3-bis(carboxymethyl)hexanedioic acid;hydride.
| Compound Name | sodium;4-amino-3,3-bis(carboxymethyl)hexanedioic acid;hydride |
|---|---|
| PubChem CID | 173286235 |
| Molecular Formula | C10H16NNaO8 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | sodium;4-amino-3,3-bis(carboxymethyl)hexanedioic acid;hydride |
| SMILES | NC(CC(=O)O)C(CC(=O)O)(CC(=O)O)CC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H15NO8.Na.H/c11-5(1-6(12)13)10(2-7(14)15,3-8(16)17)4-9(18)19;;/h5H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19);;/q;+1;-1 |
| InChIKey | ZHKXWCRQHAWVHS-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |