C12H18N2O10 — CID 87967860
2,4-diamino-3,3-bis(carboxymethyl)pentane-1,2,5-tricarboxylic acid (PubChem CID 87967860) has the molecular formula C12H18N2O10 and a molecular weight of 350.28 g/mol. Its IUPAC name is 2,4-diamino-3,3-bis(carboxymethyl)pentane-1,2,5-tricarboxylic acid.
| Compound Name | 2,4-diamino-3,3-bis(carboxymethyl)pentane-1,2,5-tricarboxylic acid |
|---|---|
| PubChem CID | 87967860 |
| Molecular Formula | C12H18N2O10 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2,4-diamino-3,3-bis(carboxymethyl)pentane-1,2,5-tricarboxylic acid |
| SMILES | NC(CC(=O)O)C(CC(=O)O)(CC(=O)O)C(N)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O10/c13-5(1-6(15)16)11(2-7(17)18,3-8(19)20)12(14,10(23)24)4-9(21)22/h5H,1-4,13-14H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | OCFLSDVFVIACOG-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 238.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |