C10H23N3O — CID 87500992
3-amino-N,N'-diethyl-N'-propan-2-ylpropanehydrazide (PubChem CID 87500992) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-amino-N,N'-diethyl-N'-propan-2-ylpropanehydrazide.
| Compound Name | 3-amino-N,N'-diethyl-N'-propan-2-ylpropanehydrazide |
|---|---|
| PubChem CID | 87500992 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 3-amino-N,N'-diethyl-N'-propan-2-ylpropanehydrazide |
| SMILES | CCN(C(=O)CCN)N(CC)C(C)C |
| InChI | InChI=1S/C10H23N3O/c1-5-12(9(3)4)13(6-2)10(14)7-8-11/h9H,5-8,11H2,1-4H3 |
| InChIKey | ZFFCKKMROUAIPJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|