C12H10Cl6O2 — CID 87501537
2-[[4-(1,1,2,2,3,3-hexachloropropyl)phenoxy]methyl]oxirane (PubChem CID 87501537) has the molecular formula C12H10Cl6O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 2-[[4-(1,1,2,2,3,3-hexachloropropyl)phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-(1,1,2,2,3,3-hexachloropropyl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87501537 |
| Molecular Formula | C12H10Cl6O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | 2-[[4-(1,1,2,2,3,3-hexachloropropyl)phenoxy]methyl]oxirane |
| SMILES | ClC(Cl)C(Cl)(Cl)C(Cl)(Cl)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C12H10Cl6O2/c13-10(14)12(17,18)11(15,16)7-1-3-8(4-2-7)19-5-9-6-20-9/h1-4,9-10H,5-6H2 |
| InChIKey | HFVCETHTNBWZNK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|