C12H20N2O — CID 87501591
4-(4-aminohexa-1,5-dien-3-yloxy)hexa-1,5-dien-3-amine (PubChem CID 87501591) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(4-aminohexa-1,5-dien-3-yloxy)hexa-1,5-dien-3-amine.
| Compound Name | 4-(4-aminohexa-1,5-dien-3-yloxy)hexa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 87501591 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-(4-aminohexa-1,5-dien-3-yloxy)hexa-1,5-dien-3-amine |
| SMILES | C=CC(N)C(C=C)OC(C=C)C(N)C=C |
| InChI | InChI=1S/C12H20N2O/c1-5-9(13)11(7-3)15-12(8-4)10(14)6-2/h5-12H,1-4,13-14H2 |
| InChIKey | FNUGZTCHIYSFCF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|