C11H22N2O — CID 87505028
N,N'-dibutylprop-2-enehydrazide (PubChem CID 87505028) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N,N'-dibutylprop-2-enehydrazide.
| Compound Name | N,N'-dibutylprop-2-enehydrazide |
|---|---|
| PubChem CID | 87505028 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N,N'-dibutylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CCCC)NCCCC |
| InChI | InChI=1S/C11H22N2O/c1-4-7-9-12-13(10-8-5-2)11(14)6-3/h6,12H,3-5,7-10H2,1-2H3 |
| InChIKey | HCNBZOUULUALCY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|