C13H10Cl2FN3OS — CID 87505899
1-(2,3-dichlorophenyl)-3-[(2-fluoro-4-pyridinyl)methyl]-1-sulfanylurea (PubChem CID 87505899) has the molecular formula C13H10Cl2FN3OS and a molecular weight of 346.21 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[(2-fluoro-4-pyridinyl)methyl]-1-sulfanylurea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[(2-fluoro-4-pyridinyl)methyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87505899 |
| Molecular Formula | C13H10Cl2FN3OS |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[(2-fluoro-4-pyridinyl)methyl]-1-sulfanylurea |
| SMILES | O=C(NCc1ccnc(F)c1)N(S)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2FN3OS/c14-9-2-1-3-10(12(9)15)19(21)13(20)18-7-8-4-5-17-11(16)6-8/h1-6,21H,7H2,(H,18,20) |
| InChIKey | VTCQKRVRNUMHIY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|