C20H24N2 — CID 87506080
4-anthracen-9-yl-3-N-ethylbutane-1,3-diamine (PubChem CID 87506080) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-anthracen-9-yl-3-N-ethylbutane-1,3-diamine.
| Compound Name | 4-anthracen-9-yl-3-N-ethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 87506080 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 4-anthracen-9-yl-3-N-ethylbutane-1,3-diamine |
| SMILES | CCNC(CCN)Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H24N2/c1-2-22-17(11-12-21)14-20-18-9-5-3-7-15(18)13-16-8-4-6-10-19(16)20/h3-10,13,17,22H,2,11-12,14,21H2,1H3 |
| InChIKey | TXBMEMTVIYLMHH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|