About butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen
butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen (PubChem CID 156724477) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen.
Molecular Properties
| Compound Name | butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen |
| PubChem CID | 156724477 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen |
| SMILES | CCCCN.OOCc1c2ccccc2cc2ccccc12.[H][H] |
| InChI | InChI=1S/C15H12O2.C4H11N.H2/c16-17-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15;1-2-3-4-5;/h1-9,16H,10H2;2-5H2,1H3;1H |
| InChIKey | BWCPUYFLSAPLEF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen?
The IUPAC name of butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen (CID 156724477) is butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen.
What is the SMILES notation for butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen?
The canonical SMILES for butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen is CCCCN.OOCc1c2ccccc2cc2ccccc12.[H][H].
What is the InChIKey of butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen?
The InChIKey is BWCPUYFLSAPLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2.C4H11N.H2/c16-17-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15;1-2-3-4-5;/h1-9,16H,10H2;2-5H2,1H3;1H.
What are the key properties of butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen?
butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen has a molecular weight of 299.41 g/mol, XLogP of 4.97, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;9-(hydroperoxymethyl)anthracene;molecular hydrogen is sourced from PubChem (CID 156724477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).