C4H6F3NO3 — CID 87508782
(2R,3R)-2-(difluoroamino)-2-fluoro-3-hydroxybutanoic acid (PubChem CID 87508782) has the molecular formula C4H6F3NO3 and a molecular weight of 173.09 g/mol. Its IUPAC name is (2R,3R)-2-(difluoroamino)-2-fluoro-3-hydroxybutanoic acid.
| Compound Name | (2R,3R)-2-(difluoroamino)-2-fluoro-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 87508782 |
| Molecular Formula | C4H6F3NO3 |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (2R,3R)-2-(difluoroamino)-2-fluoro-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@@](F)(C(=O)O)N(F)F |
| InChI | InChI=1S/C4H6F3NO3/c1-2(9)4(5,3(10)11)8(6)7/h2,9H,1H3,(H,10,11)/t2-,4+/m1/s1 |
| InChIKey | DQLCMHMRSKSMBT-FONMRSAGSA-N |
| XLogP | 0.19 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|