C15H28F5NO — CID 87509318
(2R)-3,3,4,4,4-pentafluoro-1-[hexyl(pentyl)amino]butan-2-ol (PubChem CID 87509318) has the molecular formula C15H28F5NO and a molecular weight of 333.39 g/mol. Its IUPAC name is (2R)-3,3,4,4,4-pentafluoro-1-[hexyl(pentyl)amino]butan-2-ol.
| Compound Name | (2R)-3,3,4,4,4-pentafluoro-1-[hexyl(pentyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 87509318 |
| Molecular Formula | C15H28F5NO |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (2R)-3,3,4,4,4-pentafluoro-1-[hexyl(pentyl)amino]butan-2-ol |
| SMILES | CCCCCCN(CCCCC)C[C@@H](O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H28F5NO/c1-3-5-7-9-11-21(10-8-6-4-2)12-13(22)14(16,17)15(18,19)20/h13,22H,3-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | YGYDFLQDDFAGPV-CYBMUJFWSA-N |
| XLogP | 4.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|