C14H28F3NO — CID 87509068
(2R)-1,1,1-trifluoro-3-[hexyl(pentyl)amino]propan-2-ol (PubChem CID 87509068) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[hexyl(pentyl)amino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[hexyl(pentyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 87509068 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[hexyl(pentyl)amino]propan-2-ol |
| SMILES | CCCCCCN(CCCCC)C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C14H28F3NO/c1-3-5-7-9-11-18(10-8-6-4-2)12-13(19)14(15,16)17/h13,19H,3-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | VYBCDZOZRLOOAV-CYBMUJFWSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|