C6H6BKN9 — CID 87509551
CID 87509551 (PubChem CID 87509551) has the molecular formula C6H6BKN9 and a molecular weight of 254.09 g/mol.
| Compound Name | CID 87509551 |
|---|---|
| PubChem CID | 87509551 |
| Molecular Formula | C6H6BKN9 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | — |
| SMILES | [K+].c1n[nH]nc1[B-](c1cn[nH]n1)c1cn[nH]n1 |
| InChI | InChI=1S/C6H6BN9.K/c1-4(11-14-8-1)7(5-2-9-15-12-5)6-3-10-16-13-6;/h1-3H,(H,8,11,14)(H,9,12,15)(H,10,13,16);/q-1;+1 |
| InChIKey | ICJMDDPMMXFTTP-UHFFFAOYSA-N |
| XLogP | -6.44 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | -6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|