C4H3N5S — CID 67642312
3-(2H-triazol-4-yl)-1,2,5-thiadiazole (PubChem CID 67642312) has the molecular formula C4H3N5S and a molecular weight of 153.17 g/mol. Its IUPAC name is 3-(2H-triazol-4-yl)-1,2,5-thiadiazole.
| Compound Name | 3-(2H-triazol-4-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 67642312 |
| Molecular Formula | C4H3N5S |
| Molecular Weight | 153.17 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | 3-(2H-triazol-4-yl)-1,2,5-thiadiazole |
| SMILES | c1n[nH]nc1-c1cnsn1 |
| InChI | InChI=1S/C4H3N5S/c1-3(7-9-5-1)4-2-6-10-8-4/h1-2H,(H,5,7,9) |
| InChIKey | PIMABEMZTIJNSU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |