C3H5N7O — CID 175098819
5-(2H-triazol-4-yl)-2H-tetrazole;hydrate (PubChem CID 175098819) has the molecular formula C3H5N7O and a molecular weight of 155.12 g/mol. Its IUPAC name is 5-(2H-triazol-4-yl)-2H-tetrazole;hydrate.
| Compound Name | 5-(2H-triazol-4-yl)-2H-tetrazole;hydrate |
|---|---|
| PubChem CID | 175098819 |
| Molecular Formula | C3H5N7O |
| Molecular Weight | 155.12 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 5-(2H-triazol-4-yl)-2H-tetrazole;hydrate |
| SMILES | O.c1n[nH]nc1-c1nn[nH]n1 |
| InChI | InChI=1S/C3H3N7.H2O/c1-2(5-8-4-1)3-6-9-10-7-3;/h1H,(H,4,5,8)(H,6,7,9,10);1H2 |
| InChIKey | DCTAAUASDLMQBC-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.12 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |