C18H14MoN8O2S10 — CID 87512922
dioxomolybdenum(2+);bis(N-[dithiocarboxy(1H-pyrrol-2-yl)amino]-N-(1,3-thiazol-2-yl)carbamodithioate) (PubChem CID 87512922) has the molecular formula C18H14MoN8O2S10 and a molecular weight of 790.97 g/mol. Its IUPAC name is dioxomolybdenum(2+);bis(N-[dithiocarboxy(1H-pyrrol-2-yl)amino]-N-(1,3-thiazol-2-yl)carbamodithioate).
| Compound Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(1H-pyrrol-2-yl)amino]-N-(1,3-thiazol-2-yl)carbamodithioate) |
|---|---|
| PubChem CID | 87512922 |
| Molecular Formula | C18H14MoN8O2S10 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 791.75 |
| IUPAC Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(1H-pyrrol-2-yl)amino]-N-(1,3-thiazol-2-yl)carbamodithioate) |
| SMILES | O=[Mo+2]=O.S=C(S)N(c1ccc[nH]1)N(C(=S)[S-])c1nccs1.S=C(S)N(c1ccc[nH]1)N(C(=S)[S-])c1nccs1 |
| InChI | InChI=1S/2C9H8N4S5.Mo.2O/c2*14-8(15)12(6-2-1-3-10-6)13(9(16)17)7-11-4-5-18-7;;;/h2*1-5,10H,(H,14,15)(H,16,17);;;/q;;+2;;/p-2 |
| InChIKey | HIQMKHAHDLOIDE-UHFFFAOYSA-L |
| XLogP | 5.25 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|