C9H8N4S5 — CID 87512923
[dithiocarboxy(1H-pyrrol-2-yl)amino]-(1,3-thiazol-2-yl)carbamodithioic acid (PubChem CID 87512923) has the molecular formula C9H8N4S5 and a molecular weight of 332.53 g/mol. Its IUPAC name is [dithiocarboxy(1H-pyrrol-2-yl)amino]-(1,3-thiazol-2-yl)carbamodithioic acid.
| Compound Name | [dithiocarboxy(1H-pyrrol-2-yl)amino]-(1,3-thiazol-2-yl)carbamodithioic acid |
|---|---|
| PubChem CID | 87512923 |
| Molecular Formula | C9H8N4S5 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | [dithiocarboxy(1H-pyrrol-2-yl)amino]-(1,3-thiazol-2-yl)carbamodithioic acid |
| SMILES | S=C(S)N(c1ccc[nH]1)N(C(=S)S)c1nccs1 |
| InChI | InChI=1S/C9H8N4S5/c14-8(15)12(6-2-1-3-10-6)13(9(16)17)7-11-4-5-18-7/h1-5,10H,(H,14,15)(H,16,17) |
| InChIKey | WYFMCLOTSWATQH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|