C7H7N3S — CID 141340071
4-(1,3-thiazol-2-yl)-1H-pyrrol-2-amine (PubChem CID 141340071) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-1H-pyrrol-2-amine.
| Compound Name | 4-(1,3-thiazol-2-yl)-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 141340071 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-1H-pyrrol-2-amine |
| SMILES | Nc1cc(-c2nccs2)c[nH]1 |
| InChI | InChI=1S/C7H7N3S/c8-6-3-5(4-10-6)7-9-1-2-11-7/h1-4,10H,8H2 |
| InChIKey | LTEZMGLHWHOQEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |