C11H12ClN5S — CID 90945481
[5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrol-2-yl]cyanamide (PubChem CID 90945481) has the molecular formula C11H12ClN5S and a molecular weight of 281.77 g/mol. Its IUPAC name is [5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrol-2-yl]cyanamide.
| Compound Name | [5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrol-2-yl]cyanamide |
|---|---|
| PubChem CID | 90945481 |
| Molecular Formula | C11H12ClN5S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | [5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrol-2-yl]cyanamide |
| SMILES | CCN(Cc1cnc(Cl)s1)c1ccc(NC#N)[nH]1 |
| InChI | InChI=1S/C11H12ClN5S/c1-2-17(6-8-5-14-11(12)18-8)10-4-3-9(16-10)15-7-13/h3-5,15-16H,2,6H2,1H3 |
| InChIKey | PFQGAWKDADYFLG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|