C10H12ClN3S2 — CID 90956579
5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrole-2-thiol (PubChem CID 90956579) has the molecular formula C10H12ClN3S2 and a molecular weight of 273.81 g/mol. Its IUPAC name is 5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrole-2-thiol.
| Compound Name | 5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrole-2-thiol |
|---|---|
| PubChem CID | 90956579 |
| Molecular Formula | C10H12ClN3S2 |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 5-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]-1H-pyrrole-2-thiol |
| SMILES | CCN(Cc1cnc(Cl)s1)c1ccc(S)[nH]1 |
| InChI | InChI=1S/C10H12ClN3S2/c1-2-14(8-3-4-9(15)13-8)6-7-5-12-10(11)16-7/h3-5,13,15H,2,6H2,1H3 |
| InChIKey | NVAQWWWWSBCVBP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|