C11H15N3S — CID 104599866
5-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 104599866) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104599866 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-propan-2-yl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)c1cnc(NCc2cc[nH]c2)s1 |
| InChI | InChI=1S/C11H15N3S/c1-8(2)10-7-14-11(15-10)13-6-9-3-4-12-5-9/h3-5,7-8,12H,6H2,1-2H3,(H,13,14) |
| InChIKey | AEBDRAFQJZWBNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |