C9H11N3S — CID 104599678
5-methyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 104599678) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 5-methyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-methyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104599678 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-methyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cnc(NCc2cc[nH]c2)s1 |
| InChI | InChI=1S/C9H11N3S/c1-7-4-11-9(13-7)12-6-8-2-3-10-5-8/h2-5,10H,6H2,1H3,(H,11,12) |
| InChIKey | WNOCAWGBLRTGSP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |