C10H13N3S — CID 104599809
5-ethyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 104599809) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-ethyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-ethyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104599809 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-ethyl-N-(1H-pyrrol-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCc1cnc(NCc2cc[nH]c2)s1 |
| InChI | InChI=1S/C10H13N3S/c1-2-9-7-13-10(14-9)12-6-8-3-4-11-5-8/h3-5,7,11H,2,6H2,1H3,(H,12,13) |
| InChIKey | WSQDUVRSBGODPQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |