C7H7N3S — CID 66520585
2-pyrrol-1-yl-1,3-thiazol-4-amine (PubChem CID 66520585) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 2-pyrrol-1-yl-1,3-thiazol-4-amine.
| Compound Name | 2-pyrrol-1-yl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 66520585 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-pyrrol-1-yl-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-n2cccc2)n1 |
| InChI | InChI=1S/C7H7N3S/c8-6-5-11-7(9-6)10-3-1-2-4-10/h1-5H,8H2 |
| InChIKey | FLKJJZLZBGTTMD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |