C8H10N6O2S — CID 162247974
guanidine;2-(2-nitro-1H-pyrrol-3-yl)-1,3-thiazole (PubChem CID 162247974) has the molecular formula C8H10N6O2S and a molecular weight of 254.28 g/mol. Its IUPAC name is guanidine;2-(2-nitro-1H-pyrrol-3-yl)-1,3-thiazole.
| Compound Name | guanidine;2-(2-nitro-1H-pyrrol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 162247974 |
| Molecular Formula | C8H10N6O2S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | guanidine;2-(2-nitro-1H-pyrrol-3-yl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1[nH]ccc1-c1nccs1.[H]N=C(N)N |
| InChI | InChI=1S/C7H5N3O2S.CH5N3/c11-10(12)6-5(1-2-8-6)7-9-3-4-13-7;2-1(3)4/h1-4,8H;(H5,2,3,4) |
| InChIKey | ZXPHXRCAYKRHNL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|