C8H8N4S — CID 136610520
4-(1,3-thiazol-2-yl)-1H-pyrrole-3-carboximidamide (PubChem CID 136610520) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-1H-pyrrole-3-carboximidamide.
| Compound Name | 4-(1,3-thiazol-2-yl)-1H-pyrrole-3-carboximidamide |
|---|---|
| PubChem CID | 136610520 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-1H-pyrrole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c[nH]cc1-c1nccs1 |
| InChI | InChI=1S/C8H8N4S/c9-7(10)5-3-11-4-6(5)8-12-1-2-13-8/h1-4,11H,(H3,9,10) |
| InChIKey | CKVOMJVVWJWSII-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|