About N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide
N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide (PubChem CID 140744167) has the molecular formula C7H7N3O2S2
and a molecular weight of 229.29 g/mol. Its IUPAC name is N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide |
| PubChem CID | 140744167 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc[nH]1)c1cscn1 |
| InChI | InChI=1S/C7H7N3O2S2/c11-14(12,7-4-13-5-9-7)10-6-2-1-3-8-6/h1-5,8,10H |
| InChIKey | PBGBGZMNLYAQOR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide?
The IUPAC name of N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide (CID 140744167) is N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide.
What is the SMILES notation for N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide?
The canonical SMILES for N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide is O=S(=O)(Nc1ccc[nH]1)c1cscn1.
What is the InChIKey of N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide?
The InChIKey is PBGBGZMNLYAQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S2/c11-14(12,7-4-13-5-9-7)10-6-2-1-3-8-6/h1-5,8,10H.
What are the key properties of N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide?
N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide has a molecular weight of 229.29 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrrol-2-yl)-1,3-thiazole-4-sulfonamide is sourced from PubChem (CID 140744167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).