C10H14N4S5 — CID 87511186
[dithiocarboxy(1H-pyrrol-2-yl)amino]-thiomorpholin-4-ylcarbamodithioic acid (PubChem CID 87511186) has the molecular formula C10H14N4S5 and a molecular weight of 350.59 g/mol. Its IUPAC name is [dithiocarboxy(1H-pyrrol-2-yl)amino]-thiomorpholin-4-ylcarbamodithioic acid.
| Compound Name | [dithiocarboxy(1H-pyrrol-2-yl)amino]-thiomorpholin-4-ylcarbamodithioic acid |
|---|---|
| PubChem CID | 87511186 |
| Molecular Formula | C10H14N4S5 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | [dithiocarboxy(1H-pyrrol-2-yl)amino]-thiomorpholin-4-ylcarbamodithioic acid |
| SMILES | S=C(S)N(c1ccc[nH]1)N(C(=S)S)N1CCSCC1 |
| InChI | InChI=1S/C10H14N4S5/c15-9(16)13(8-2-1-3-11-8)14(10(17)18)12-4-6-19-7-5-12/h1-3,11H,4-7H2,(H,15,16)(H,17,18) |
| InChIKey | GUGJGRJBYACFTG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|