C9H10N4OS — CID 141120127
3-(1H-pyrrol-2-yl)-2-(3H-1,2-thiazol-2-yl)oxadiazole (PubChem CID 141120127) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-yl)-2-(3H-1,2-thiazol-2-yl)oxadiazole.
| Compound Name | 3-(1H-pyrrol-2-yl)-2-(3H-1,2-thiazol-2-yl)oxadiazole |
|---|---|
| PubChem CID | 141120127 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-(1H-pyrrol-2-yl)-2-(3H-1,2-thiazol-2-yl)oxadiazole |
| SMILES | C1=CSN(N2OC=CN2c2ccc[nH]2)C1 |
| InChI | InChI=1S/C9H10N4OS/c1-3-9(10-4-1)11-6-7-14-13(11)12-5-2-8-15-12/h1-4,6-8,10H,5H2 |
| InChIKey | HYWQAOWOAMKTHE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|