C18H41NO5P2 — CID 87513101
2-[1,6-bis(3,3-dimethoxypropylphosphanyl)hexan-3-yloxy]ethanamine (PubChem CID 87513101) has the molecular formula C18H41NO5P2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[1,6-bis(3,3-dimethoxypropylphosphanyl)hexan-3-yloxy]ethanamine.
| Compound Name | 2-[1,6-bis(3,3-dimethoxypropylphosphanyl)hexan-3-yloxy]ethanamine |
|---|---|
| PubChem CID | 87513101 |
| Molecular Formula | C18H41NO5P2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2-[1,6-bis(3,3-dimethoxypropylphosphanyl)hexan-3-yloxy]ethanamine |
| SMILES | COC(CCPCCCC(CCPCCC(OC)OC)OCCN)OC |
| InChI | InChI=1S/C18H41NO5P2/c1-20-17(21-2)8-14-25-12-5-6-16(24-11-10-19)7-13-26-15-9-18(22-3)23-4/h16-18,25-26H,5-15,19H2,1-4H3 |
| InChIKey | SJFYVIWGYVRNEZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|