C23H51NO5P2 — CID 87513692
2-[1,7-bis(3,3-diethoxypropylphosphanyl)heptan-3-yloxy]ethanamine (PubChem CID 87513692) has the molecular formula C23H51NO5P2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[1,7-bis(3,3-diethoxypropylphosphanyl)heptan-3-yloxy]ethanamine.
| Compound Name | 2-[1,7-bis(3,3-diethoxypropylphosphanyl)heptan-3-yloxy]ethanamine |
|---|---|
| PubChem CID | 87513692 |
| Molecular Formula | C23H51NO5P2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | 2-[1,7-bis(3,3-diethoxypropylphosphanyl)heptan-3-yloxy]ethanamine |
| SMILES | CCOC(CCPCCCCC(CCPCCC(OCC)OCC)OCCN)OCC |
| InChI | InChI=1S/C23H51NO5P2/c1-5-25-22(26-6-2)13-19-30-17-10-9-11-21(29-16-15-24)12-18-31-20-14-23(27-7-3)28-8-4/h21-23,30-31H,5-20,24H2,1-4H3 |
| InChIKey | HFBCGZPPILMIKE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|