C23H51NO5P2 — CID 87357469
4-(3,3-diethoxypropylphosphanyl)-N-[2-(3,3-diethoxypropylphosphanyl)ethyl]-N-propoxybutan-2-amine (PubChem CID 87357469) has the molecular formula C23H51NO5P2 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-(3,3-diethoxypropylphosphanyl)-N-[2-(3,3-diethoxypropylphosphanyl)ethyl]-N-propoxybutan-2-amine.
| Compound Name | 4-(3,3-diethoxypropylphosphanyl)-N-[2-(3,3-diethoxypropylphosphanyl)ethyl]-N-propoxybutan-2-amine |
|---|---|
| PubChem CID | 87357469 |
| Molecular Formula | C23H51NO5P2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | 4-(3,3-diethoxypropylphosphanyl)-N-[2-(3,3-diethoxypropylphosphanyl)ethyl]-N-propoxybutan-2-amine |
| SMILES | CCCON(CCPCCC(OCC)OCC)C(C)CCPCCC(OCC)OCC |
| InChI | InChI=1S/C23H51NO5P2/c1-7-16-29-24(15-20-31-19-14-23(27-10-4)28-11-5)21(6)12-17-30-18-13-22(25-8-2)26-9-3/h21-23,30-31H,7-20H2,1-6H3 |
| InChIKey | NGOZOYGBIRMJTD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|