C27H59NO5P2 — CID 123414810
4-(3,3-dipropoxypropylphosphanyl)-2-[2-(3,3-dipropoxypropylphosphanyl)ethyl]-2-propan-2-yloxybutan-1-amine (PubChem CID 123414810) has the molecular formula C27H59NO5P2 and a molecular weight of 539.72 g/mol. Its IUPAC name is 4-(3,3-dipropoxypropylphosphanyl)-2-[2-(3,3-dipropoxypropylphosphanyl)ethyl]-2-propan-2-yloxybutan-1-amine.
| Compound Name | 4-(3,3-dipropoxypropylphosphanyl)-2-[2-(3,3-dipropoxypropylphosphanyl)ethyl]-2-propan-2-yloxybutan-1-amine |
|---|---|
| PubChem CID | 123414810 |
| Molecular Formula | C27H59NO5P2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.39 |
| IUPAC Name | 4-(3,3-dipropoxypropylphosphanyl)-2-[2-(3,3-dipropoxypropylphosphanyl)ethyl]-2-propan-2-yloxybutan-1-amine |
| SMILES | CCCOC(CCPCCC(CN)(CCPCCC(OCCC)OCCC)OC(C)C)OCCC |
| InChI | InChI=1S/C27H59NO5P2/c1-7-15-29-25(30-16-8-2)11-19-34-21-13-27(23-28,33-24(5)6)14-22-35-20-12-26(31-17-9-3)32-18-10-4/h24-26,34-35H,7-23,28H2,1-6H3 |
| InChIKey | SUDURTXUBKGLKS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|