C22H21N5O2S — CID 8751334
1-[4-[2-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]pyrrolidin-2-one (PubChem CID 8751334) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-[4-[2-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8751334 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[4-[2-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]phenyl]pyrrolidin-2-one |
| SMILES | C=CCn1c(SCC(=O)c2ccc(N3CCCC3=O)cc2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-2-12-27-21(17-5-3-11-23-14-17)24-25-22(27)30-15-19(28)16-7-9-18(10-8-16)26-13-4-6-20(26)29/h2-3,5,7-11,14H,1,4,6,12-13,15H2 |
| InChIKey | HJOSITIYKJDZJN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|