C6H10N3O+ — CID 87517663
3,3-dimethylimidazol-3-ium-4-carboxamide (PubChem CID 87517663) has the molecular formula C6H10N3O+ and a molecular weight of 140.17 g/mol. Its IUPAC name is 3,3-dimethylimidazol-3-ium-4-carboxamide.
| Compound Name | 3,3-dimethylimidazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 87517663 |
| Molecular Formula | C6H10N3O+ |
| Molecular Weight | 140.17 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3,3-dimethylimidazol-3-ium-4-carboxamide |
| SMILES | C[N+]1(C)C=NC=C1C(N)=O |
| InChI | InChI=1S/C6H9N3O/c1-9(2)4-8-3-5(9)6(7)10/h3-4H,1-2H3,(H-,7,10)/p+1 |
| InChIKey | MCUWWMDMUNDVLL-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|