C13H15NO6 — CID 87518319
2-[hydroxy(phenyl)carbamoyl]-2-methylpentanedioic acid (PubChem CID 87518319) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)carbamoyl]-2-methylpentanedioic acid.
| Compound Name | 2-[hydroxy(phenyl)carbamoyl]-2-methylpentanedioic acid |
|---|---|
| PubChem CID | 87518319 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[hydroxy(phenyl)carbamoyl]-2-methylpentanedioic acid |
| SMILES | CC(CCC(=O)O)(C(=O)O)C(=O)N(O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO6/c1-13(12(18)19,8-7-10(15)16)11(17)14(20)9-5-3-2-4-6-9/h2-6,20H,7-8H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | GHZMDHOLDOCSME-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|