C9H11NO5 — CID 54393862
(2R)-2,3-dihydroxy-2-(N-hydroxyanilino)propanoic acid (PubChem CID 54393862) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-2-(N-hydroxyanilino)propanoic acid.
| Compound Name | (2R)-2,3-dihydroxy-2-(N-hydroxyanilino)propanoic acid |
|---|---|
| PubChem CID | 54393862 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2R)-2,3-dihydroxy-2-(N-hydroxyanilino)propanoic acid |
| SMILES | O=C(O)[C@](O)(CO)N(O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO5/c11-6-9(14,8(12)13)10(15)7-4-2-1-3-5-7/h1-5,11,14-15H,6H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | VIOHLUFJBKTVTD-SECBINFHSA-N |
| XLogP | -0.35 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|