C31H30F7N7O5S — CID 87520228
1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-methyl-3-pyridinyl]-3-[1-(4-methylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]urea;methanesulfonic acid (PubChem CID 87520228) has the molecular formula C31H30F7N7O5S and a molecular weight of 745.68 g/mol. Its IUPAC name is 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-methyl-3-pyridinyl]-3-[1-(4-methylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]urea;methanesulfonic acid.
| Compound Name | 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-methyl-3-pyridinyl]-3-[1-(4-methylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]urea;methanesulfonic acid |
|---|---|
| PubChem CID | 87520228 |
| Molecular Formula | C31H30F7N7O5S |
| Molecular Weight | 745.68 g/mol |
| Exact Mass | 745.19 |
| IUPAC Name | 1-[6-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-methyl-3-pyridinyl]-3-[1-(4-methylphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]urea;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(-n2nc(C(F)(F)C(F)(F)F)cc2NC(=O)Nc2ccc(N3CCN(C(=O)c4c(F)cccc4F)CC3)nc2C)cc1 |
| InChI | InChI=1S/C30H26F7N7O2.CH4O3S/c1-17-6-8-19(9-7-17)44-25(16-23(41-44)29(33,34)30(35,36)37)40-28(46)39-22-10-11-24(38-18(22)2)42-12-14-43(15-13-42)27(45)26-20(31)4-3-5-21(26)32;1-5(2,3)4/h3-11,16H,12-15H2,1-2H3,(H2,39,40,46);1H3,(H,2,3,4) |
| InChIKey | BEXANQBRRFMQBU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.68 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|