About 2-methylpentane-1,5-diamine;dihydrochloride
2-methylpentane-1,5-diamine;dihydrochloride (PubChem CID 87520320) has the molecular formula C6H18Cl2N2
and a molecular weight of 189.13 g/mol. Its IUPAC name is 2-methylpentane-1,5-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylpentane-1,5-diamine;dihydrochloride |
| PubChem CID | 87520320 |
| Molecular Formula | C6H18Cl2N2 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-methylpentane-1,5-diamine;dihydrochloride |
| SMILES | CC(CN)CCCN.Cl.Cl |
| InChI | InChI=1S/C6H16N2.2ClH/c1-6(5-8)3-2-4-7;;/h6H,2-5,7-8H2,1H3;2*1H |
| InChIKey | APTRWOLNEUAQEI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpentane-1,5-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane-1,5-diamine;dihydrochloride?
The IUPAC name of 2-methylpentane-1,5-diamine;dihydrochloride (CID 87520320) is 2-methylpentane-1,5-diamine;dihydrochloride.
What is the SMILES notation for 2-methylpentane-1,5-diamine;dihydrochloride?
The canonical SMILES for 2-methylpentane-1,5-diamine;dihydrochloride is CC(CN)CCCN.Cl.Cl.
What is the InChIKey of 2-methylpentane-1,5-diamine;dihydrochloride?
The InChIKey is APTRWOLNEUAQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.2ClH/c1-6(5-8)3-2-4-7;;/h6H,2-5,7-8H2,1H3;2*1H.
What are the key properties of 2-methylpentane-1,5-diamine;dihydrochloride?
2-methylpentane-1,5-diamine;dihydrochloride has a molecular weight of 189.13 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane-1,5-diamine;dihydrochloride is sourced from PubChem (CID 87520320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).